C30H24N4O3S — CID 19162543
[4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(phenylcarbamothioylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19162543) has the molecular formula C30H24N4O3S and a molecular weight of 520.61 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(phenylcarbamothioylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(phenylcarbamothioylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19162543 |
| Molecular Formula | C30H24N4O3S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] (4E)-3-methyl-4-(phenylcarbamothioylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)oc2c1/C(=N/NC(=S)Nc1ccccc1)CCC2 |
| InChI | InChI=1S/C30H24N4O3S/c1-19-27-25(33-34-30(38)32-23-6-3-2-4-7-23)8-5-9-26(27)37-28(19)29(35)36-24-16-14-22(15-17-24)21-12-10-20(18-31)11-13-21/h2-4,6-7,10-17H,5,8-9H2,1H3,(H2,32,34,38)/b33-25+ |
| InChIKey | FQCHBYMVKJLWPS-INKHBPHZSA-N |
| XLogP | 6.37 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|