C23H19FN2O5 — CID 19163273
(4-fluorophenyl) (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19163273) has the molecular formula C23H19FN2O5 and a molecular weight of 422.41 g/mol. Its IUPAC name is (4-fluorophenyl) (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (4-fluorophenyl) (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19163273 |
| Molecular Formula | C23H19FN2O5 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (4-fluorophenyl) (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(F)cc2)oc2c1/C(=N/NC(=O)c1ccccc1O)CCC2 |
| InChI | InChI=1S/C23H19FN2O5/c1-13-20-17(25-26-22(28)16-5-2-3-7-18(16)27)6-4-8-19(20)31-21(13)23(29)30-15-11-9-14(24)10-12-15/h2-3,5,7,9-12,27H,4,6,8H2,1H3,(H,26,28)/b25-17+ |
| InChIKey | SGLUHNXMAGRMEI-KOEQRZSOSA-N |
| XLogP | 4.12 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|