C23H27N3O4 — CID 19163174
N-[(E)-[2-(azepane-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide (PubChem CID 19163174) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(E)-[2-(azepane-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-[2-(azepane-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 19163174 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[(E)-[2-(azepane-1-carbonyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-2-hydroxybenzamide |
| SMILES | Cc1c(C(=O)N2CCCCCC2)oc2c1/C(=N/NC(=O)c1ccccc1O)CCC2 |
| InChI | InChI=1S/C23H27N3O4/c1-15-20-17(24-25-22(28)16-9-4-5-11-18(16)27)10-8-12-19(20)30-21(15)23(29)26-13-6-2-3-7-14-26/h4-5,9,11,27H,2-3,6-8,10,12-14H2,1H3,(H,25,28)/b24-17+ |
| InChIKey | NSDXDAKRQSDOGD-JJIBRWJFSA-N |
| XLogP | 3.78 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|