C27H22N2O5 — CID 19163147
naphthalen-2-yl (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19163147) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is naphthalen-2-yl (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | naphthalen-2-yl (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19163147 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | naphthalen-2-yl (4E)-4-[(2-hydroxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc3ccccc3c2)oc2c1/C(=N/NC(=O)c1ccccc1O)CCC2 |
| InChI | InChI=1S/C27H22N2O5/c1-16-24-21(28-29-26(31)20-9-4-5-11-22(20)30)10-6-12-23(24)34-25(16)27(32)33-19-14-13-17-7-2-3-8-18(17)15-19/h2-5,7-9,11,13-15,30H,6,10,12H2,1H3,(H,29,31)/b28-21+ |
| InChIKey | HVBUJCZYCBLUOO-SGWCAAJKSA-N |
| XLogP | 5.14 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|