C26H20ClN3O4 — CID 19156864
quinolin-8-yl (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19156864) has the molecular formula C26H20ClN3O4 and a molecular weight of 473.92 g/mol. Its IUPAC name is quinolin-8-yl (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | quinolin-8-yl (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19156864 |
| Molecular Formula | C26H20ClN3O4 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | quinolin-8-yl (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2cccc3cccnc23)oc2c1/C(=N/NC(=O)c1ccccc1Cl)CCC2 |
| InChI | InChI=1S/C26H20ClN3O4/c1-15-22-19(29-30-25(31)17-9-2-3-10-18(17)27)11-5-12-20(22)33-24(15)26(32)34-21-13-4-7-16-8-6-14-28-23(16)21/h2-4,6-10,13-14H,5,11-12H2,1H3,(H,30,31)/b29-19+ |
| InChIKey | PIZANBATWVDQLM-VUTHCHCSSA-N |
| XLogP | 5.48 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|