C27H22N4O6 — CID 19157201
(2-methylquinolin-8-yl) (4E)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19157201) has the molecular formula C27H22N4O6 and a molecular weight of 498.50 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) (4E)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (2-methylquinolin-8-yl) (4E)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19157201 |
| Molecular Formula | C27H22N4O6 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (2-methylquinolin-8-yl) (4E)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc2cccc(OC(=O)c3oc4c(c3C)/C(=N/NC(=O)c3cccc([N+](=O)[O-])c3)CCC4)c2n1 |
| InChI | InChI=1S/C27H22N4O6/c1-15-12-13-17-6-4-11-22(24(17)28-15)37-27(33)25-16(2)23-20(9-5-10-21(23)36-25)29-30-26(32)18-7-3-8-19(14-18)31(34)35/h3-4,6-8,11-14H,5,9-10H2,1-2H3,(H,30,32)/b29-20+ |
| InChIKey | IDXIWIGWINBMME-ZTKZIYFRSA-N |
| XLogP | 5.04 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|