C23H19BrN4O5 — CID 19157157
(4E)-N-(2-bromophenyl)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19157157) has the molecular formula C23H19BrN4O5 and a molecular weight of 511.33 g/mol. Its IUPAC name is (4E)-N-(2-bromophenyl)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-bromophenyl)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19157157 |
| Molecular Formula | C23H19BrN4O5 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (4E)-N-(2-bromophenyl)-3-methyl-4-[(3-nitrobenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2Br)oc2c1/C(=N/NC(=O)c1cccc([N+](=O)[O-])c1)CCC2 |
| InChI | InChI=1S/C23H19BrN4O5/c1-13-20-18(26-27-22(29)14-6-4-7-15(12-14)28(31)32)10-5-11-19(20)33-21(13)23(30)25-17-9-3-2-8-16(17)24/h2-4,6-9,12H,5,10-11H2,1H3,(H,25,30)(H,27,29)/b26-18+ |
| InChIKey | SNSFIKIGINDDHQ-NLRVBDNBSA-N |
| XLogP | 4.98 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|