C24H20N6O8 — CID 19157179
N-[(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-nitrobenzamide (PubChem CID 19157179) has the molecular formula C24H20N6O8 and a molecular weight of 520.46 g/mol. Its IUPAC name is N-[(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19157179 |
| Molecular Formula | C24H20N6O8 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | N-[(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)oc2c1/C(=N/NC(=O)c1cccc([N+](=O)[O-])c1)CCC2 |
| InChI | InChI=1S/C24H20N6O8/c1-13-20-18(25-26-23(32)15-4-2-5-17(12-15)30(36)37)6-3-7-19(20)38-21(13)24(33)28-27-22(31)14-8-10-16(11-9-14)29(34)35/h2,4-5,8-12H,3,6-7H2,1H3,(H,26,32)(H,27,31)(H,28,33)/b25-18+ |
| InChIKey | DFDJFPVZKZIADN-XIEYBQDHSA-N |
| XLogP | 2.95 |
| TPSA | 199.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|