C18H18N6O5S — CID 19162214
[(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]thiourea (PubChem CID 19162214) has the molecular formula C18H18N6O5S and a molecular weight of 430.45 g/mol. Its IUPAC name is [(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]thiourea.
| Compound Name | [(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 19162214 |
| Molecular Formula | C18H18N6O5S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [(E)-[3-methyl-2-[[(4-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]thiourea |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)oc2c1/C(=N/NC(N)=S)CCC2 |
| InChI | InChI=1S/C18H18N6O5S/c1-9-14-12(20-23-18(19)30)3-2-4-13(14)29-15(9)17(26)22-21-16(25)10-5-7-11(8-6-10)24(27)28/h5-8H,2-4H2,1H3,(H,21,25)(H,22,26)(H3,19,23,30)/b20-12+ |
| InChIKey | KSOXJCBABRJPKR-UDWIEESQSA-N |
| XLogP | 1.44 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|