C24H21BrN4O5 — CID 19156336
N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide (PubChem CID 19156336) has the molecular formula C24H21BrN4O5 and a molecular weight of 525.36 g/mol. Its IUPAC name is N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide.
| Compound Name | N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 19156336 |
| Molecular Formula | C24H21BrN4O5 |
| Molecular Weight | 525.36 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | N-[(E)-[2-[[(4-bromobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Br)cc2)oc2c1/C(=N/NC(=O)c1ccc(O)cc1)CCC2 |
| InChI | InChI=1S/C24H21BrN4O5/c1-13-20-18(26-27-22(31)15-7-11-17(30)12-8-15)3-2-4-19(20)34-21(13)24(33)29-28-23(32)14-5-9-16(25)10-6-14/h5-12,30H,2-4H2,1H3,(H,27,31)(H,28,32)(H,29,33)/b26-18+ |
| InChIKey | GJEDEFVCUTZAOD-NLRVBDNBSA-N |
| XLogP | 3.60 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|