C24H20Cl2N4O5 — CID 19156345
N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide (PubChem CID 19156345) has the molecular formula C24H20Cl2N4O5 and a molecular weight of 515.35 g/mol. Its IUPAC name is N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide.
| Compound Name | N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 19156345 |
| Molecular Formula | C24H20Cl2N4O5 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-hydroxybenzamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)cc2Cl)oc2c1/C(=N/NC(=O)c1ccc(O)cc1)CCC2 |
| InChI | InChI=1S/C24H20Cl2N4O5/c1-12-20-18(27-28-22(32)13-5-8-15(31)9-6-13)3-2-4-19(20)35-21(12)24(34)30-29-23(33)16-10-7-14(25)11-17(16)26/h5-11,31H,2-4H2,1H3,(H,28,32)(H,29,33)(H,30,34)/b27-18+ |
| InChIKey | QCHDNQRZBCAGJJ-OVVQPSECSA-N |
| XLogP | 4.15 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|