C24H19Cl3N4O4 — CID 19158015
2,4-dichloro-N-[(E)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide (PubChem CID 19158015) has the molecular formula C24H19Cl3N4O4 and a molecular weight of 533.80 g/mol. Its IUPAC name is 2,4-dichloro-N-[(E)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide.
| Compound Name | 2,4-dichloro-N-[(E)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 19158015 |
| Molecular Formula | C24H19Cl3N4O4 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 2,4-dichloro-N-[(E)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]benzamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)cc2)oc2c1/C(=N/NC(=O)c1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C24H19Cl3N4O4/c1-12-20-18(28-30-23(33)16-10-9-15(26)11-17(16)27)3-2-4-19(20)35-21(12)24(34)31-29-22(32)13-5-7-14(25)8-6-13/h5-11H,2-4H2,1H3,(H,29,32)(H,30,33)(H,31,34)/b28-18+ |
| InChIKey | TXFGPEMEPASBGD-MTDXEUNCSA-N |
| XLogP | 5.09 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|