C23H18Cl2IN3O3 — CID 19158006
(4E)-4-[(2,4-dichlorobenzoyl)hydrazinylidene]-N-(4-iodophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19158006) has the molecular formula C23H18Cl2IN3O3 and a molecular weight of 582.23 g/mol. Its IUPAC name is (4E)-4-[(2,4-dichlorobenzoyl)hydrazinylidene]-N-(4-iodophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2,4-dichlorobenzoyl)hydrazinylidene]-N-(4-iodophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19158006 |
| Molecular Formula | C23H18Cl2IN3O3 |
| Molecular Weight | 582.23 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | (4E)-4-[(2,4-dichlorobenzoyl)hydrazinylidene]-N-(4-iodophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(I)cc2)oc2c1/C(=N/NC(=O)c1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C23H18Cl2IN3O3/c1-12-20-18(28-29-22(30)16-10-5-13(24)11-17(16)25)3-2-4-19(20)32-21(12)23(31)27-15-8-6-14(26)7-9-15/h5-11H,2-4H2,1H3,(H,27,31)(H,29,30)/b28-18+ |
| InChIKey | VPQMOZWISZOBMW-MTDXEUNCSA-N |
| XLogP | 6.22 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|