C22H19Cl2N3O4 — CID 19161110
(4E)-N-(2,4-dichlorophenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161110) has the molecular formula C22H19Cl2N3O4 and a molecular weight of 460.32 g/mol. Its IUPAC name is (4E)-N-(2,4-dichlorophenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2,4-dichlorophenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161110 |
| Molecular Formula | C22H19Cl2N3O4 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (4E)-N-(2,4-dichlorophenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1occc1C(=O)N/N=C1\CCCc2oc(C(=O)Nc3ccc(Cl)cc3Cl)c(C)c21 |
| InChI | InChI=1S/C22H19Cl2N3O4/c1-11-19-17(26-27-21(28)14-8-9-30-12(14)2)4-3-5-18(19)31-20(11)22(29)25-16-7-6-13(23)10-15(16)24/h6-10H,3-5H2,1-2H3,(H,25,29)(H,27,28)/b26-17+ |
| InChIKey | KSLHPRHCLBLMRF-YZSQISJMSA-N |
| XLogP | 5.52 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|