C28H24ClN3O5 — CID 19161229
(4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161229) has the molecular formula C28H24ClN3O5 and a molecular weight of 517.97 g/mol. Its IUPAC name is (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161229 |
| Molecular Formula | C28H24ClN3O5 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (4E)-N-(5-chloro-2-phenoxyphenyl)-3-methyl-4-[(2-methylfuran-3-carbonyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1occc1C(=O)N/N=C1\CCCc2oc(C(=O)Nc3cc(Cl)ccc3Oc3ccccc3)c(C)c21 |
| InChI | InChI=1S/C28H24ClN3O5/c1-16-25-21(31-32-27(33)20-13-14-35-17(20)2)9-6-10-24(25)37-26(16)28(34)30-22-15-18(29)11-12-23(22)36-19-7-4-3-5-8-19/h3-5,7-8,11-15H,6,9-10H2,1-2H3,(H,30,34)(H,32,33)/b31-21+ |
| InChIKey | JSSRGOXXZRDXQD-NJZRLIGZSA-N |
| XLogP | 6.66 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|