C28H23ClN4O4 — CID 19158711
N-[(E)-[2-[(5-chloro-2-phenoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide (PubChem CID 19158711) has the molecular formula C28H23ClN4O4 and a molecular weight of 514.97 g/mol. Its IUPAC name is N-[(E)-[2-[(5-chloro-2-phenoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-[2-[(5-chloro-2-phenoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19158711 |
| Molecular Formula | C28H23ClN4O4 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-[(E)-[2-[(5-chloro-2-phenoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Oc2ccccc2)oc2c1/C(=N/NC(=O)c1ccccn1)CCC2 |
| InChI | InChI=1S/C28H23ClN4O4/c1-17-25-20(32-33-27(34)21-10-5-6-15-30-21)11-7-12-24(25)37-26(17)28(35)31-22-16-18(29)13-14-23(22)36-19-8-3-2-4-9-19/h2-6,8-10,13-16H,7,11-12H2,1H3,(H,31,35)(H,33,34)/b32-20+ |
| InChIKey | QYCLGZFUJHFMMG-UZWMFBFFSA-N |
| XLogP | 6.15 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|