C29H23BrClN3O4 — CID 19157031
(4E)-4-[(2-bromobenzoyl)hydrazinylidene]-N-(5-chloro-2-phenoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19157031) has the molecular formula C29H23BrClN3O4 and a molecular weight of 592.88 g/mol. Its IUPAC name is (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-N-(5-chloro-2-phenoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-N-(5-chloro-2-phenoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19157031 |
| Molecular Formula | C29H23BrClN3O4 |
| Molecular Weight | 592.88 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-N-(5-chloro-2-phenoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Oc2ccccc2)oc2c1/C(=N/NC(=O)c1ccccc1Br)CCC2 |
| InChI | InChI=1S/C29H23BrClN3O4/c1-17-26-22(33-34-28(35)20-10-5-6-11-21(20)30)12-7-13-25(26)38-27(17)29(36)32-23-16-18(31)14-15-24(23)37-19-8-3-2-4-9-19/h2-6,8-11,14-16H,7,12-13H2,1H3,(H,32,36)(H,34,35)/b33-22+ |
| InChIKey | PHHPBXALHCIJGW-STKMKYKTSA-N |
| XLogP | 7.52 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|