C29H23Cl2N3O3 — CID 19160674
(4E)-N-(2,5-dichlorophenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160674) has the molecular formula C29H23Cl2N3O3 and a molecular weight of 532.43 g/mol. Its IUPAC name is (4E)-N-(2,5-dichlorophenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2,5-dichlorophenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160674 |
| Molecular Formula | C29H23Cl2N3O3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | (4E)-N-(2,5-dichlorophenyl)-3-methyl-4-[(4-phenylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Cl)oc2c1/C(=N/NC(=O)c1ccc(-c3ccccc3)cc1)CCC2 |
| InChI | InChI=1S/C29H23Cl2N3O3/c1-17-26-23(33-34-28(35)20-12-10-19(11-13-20)18-6-3-2-4-7-18)8-5-9-25(26)37-27(17)29(36)32-24-16-21(30)14-15-22(24)31/h2-4,6-7,10-16H,5,8-9H2,1H3,(H,32,36)(H,34,35)/b33-23+ |
| InChIKey | UMXDYNIPEKEDMO-GZZLJNBRSA-N |
| XLogP | 7.28 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|