C23H19BrClN3O3 — CID 19155980
(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19155980) has the molecular formula C23H19BrClN3O3 and a molecular weight of 500.78 g/mol. Its IUPAC name is (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19155980 |
| Molecular Formula | C23H19BrClN3O3 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2Cl)oc2c1/C(=N/NC(=O)c1ccc(Br)cc1)CCC2 |
| InChI | InChI=1S/C23H19BrClN3O3/c1-13-20-18(27-28-22(29)14-9-11-15(24)12-10-14)7-4-8-19(20)31-21(13)23(30)26-17-6-3-2-5-16(17)25/h2-3,5-6,9-12H,4,7-8H2,1H3,(H,26,30)(H,28,29)/b27-18+ |
| InChIKey | LDAWZJUFNVSKPQ-OVVQPSECSA-N |
| XLogP | 5.73 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|