C24H21BrClN3O3 — CID 19155899
(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-[(2-chlorophenyl)methyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19155899) has the molecular formula C24H21BrClN3O3 and a molecular weight of 514.81 g/mol. Its IUPAC name is (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-[(2-chlorophenyl)methyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-[(2-chlorophenyl)methyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19155899 |
| Molecular Formula | C24H21BrClN3O3 |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | (4E)-4-[(4-bromobenzoyl)hydrazinylidene]-N-[(2-chlorophenyl)methyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2Cl)oc2c1/C(=N/NC(=O)c1ccc(Br)cc1)CCC2 |
| InChI | InChI=1S/C24H21BrClN3O3/c1-14-21-19(28-29-23(30)15-9-11-17(25)12-10-15)7-4-8-20(21)32-22(14)24(31)27-13-16-5-2-3-6-18(16)26/h2-3,5-6,9-12H,4,7-8,13H2,1H3,(H,27,31)(H,29,30)/b28-19+ |
| InChIKey | MTAQNPNJQWZPDY-TURZUDJPSA-N |
| XLogP | 5.40 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|