C25H24ClN3O3 — CID 19155227
(4E)-N-[(2-chlorophenyl)methyl]-3-methyl-4-[(4-methylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19155227) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is (4E)-N-[(2-chlorophenyl)methyl]-3-methyl-4-[(4-methylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-[(2-chlorophenyl)methyl]-3-methyl-4-[(4-methylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19155227 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (4E)-N-[(2-chlorophenyl)methyl]-3-methyl-4-[(4-methylbenzoyl)hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C2\CCCc3oc(C(=O)NCc4ccccc4Cl)c(C)c32)cc1 |
| InChI | InChI=1S/C25H24ClN3O3/c1-15-10-12-17(13-11-15)24(30)29-28-20-8-5-9-21-22(20)16(2)23(32-21)25(31)27-14-18-6-3-4-7-19(18)26/h3-4,6-7,10-13H,5,8-9,14H2,1-2H3,(H,27,31)(H,29,30)/b28-20+ |
| InChIKey | DUYWADHHLNUZKK-VFCFBJKWSA-N |
| XLogP | 4.95 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|