C26H24BrN3O5 — CID 19155907
methyl 2-[[(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate (PubChem CID 19155907) has the molecular formula C26H24BrN3O5 and a molecular weight of 538.40 g/mol. Its IUPAC name is methyl 2-[[(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate.
| Compound Name | methyl 2-[[(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19155907 |
| Molecular Formula | C26H24BrN3O5 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | methyl 2-[[(4E)-4-[(4-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccc(Br)cc1)CCC2 |
| InChI | InChI=1S/C26H24BrN3O5/c1-15-22-19(28-29-24(31)16-11-13-17(27)14-12-16)8-6-10-21(22)35-23(15)25(32)30(2)20-9-5-4-7-18(20)26(33)34-3/h4-5,7,9,11-14H,6,8,10H2,1-3H3,(H,29,31)/b28-19+ |
| InChIKey | FDTKZEJWZHPJOL-TURZUDJPSA-N |
| XLogP | 4.88 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|