C25H23N5O8 — CID 19159265
methyl 2-[[(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate (PubChem CID 19159265) has the molecular formula C25H23N5O8 and a molecular weight of 521.49 g/mol. Its IUPAC name is methyl 2-[[(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate.
| Compound Name | methyl 2-[[(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19159265 |
| Molecular Formula | C25H23N5O8 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | methyl 2-[[(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbonyl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C(=O)c1oc2c(c1C)/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C25H23N5O8/c1-14-22-18(27-26-17-12-11-15(29(33)34)13-20(17)30(35)36)8-6-10-21(22)38-23(14)24(31)28(2)19-9-5-4-7-16(19)25(32)37-3/h4-5,7,9,11-13,26H,6,8,10H2,1-3H3/b27-18+ |
| InChIKey | ZCEVFXIIPCVQLW-OVVQPSECSA-N |
| XLogP | 4.62 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|