C23H19FN6O7 — CID 19159362
(4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N'-(2-fluorobenzoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide (PubChem CID 19159362) has the molecular formula C23H19FN6O7 and a molecular weight of 510.44 g/mol. Its IUPAC name is (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N'-(2-fluorobenzoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide.
| Compound Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N'-(2-fluorobenzoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 19159362 |
| Molecular Formula | C23H19FN6O7 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-N'-(2-fluorobenzoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2F)oc2c1/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C23H19FN6O7/c1-12-20-17(26-25-16-10-9-13(29(33)34)11-18(16)30(35)36)7-4-8-19(20)37-21(12)23(32)28-27-22(31)14-5-2-3-6-15(14)24/h2-3,5-6,9-11,25H,4,7-8H2,1H3,(H,27,31)(H,28,32)/b26-17+ |
| InChIKey | ZWLCTEQFNFXTSL-YZSQISJMSA-N |
| XLogP | 3.77 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|