C26H21N5O7 — CID 19159383
(2-methylquinolin-8-yl) (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19159383) has the molecular formula C26H21N5O7 and a molecular weight of 515.48 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (2-methylquinolin-8-yl) (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19159383 |
| Molecular Formula | C26H21N5O7 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (2-methylquinolin-8-yl) (4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc2cccc(OC(=O)c3oc4c(c3C)/C(=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])CCC4)c2n1 |
| InChI | InChI=1S/C26H21N5O7/c1-14-9-10-16-5-3-8-22(24(16)27-14)38-26(32)25-15(2)23-19(6-4-7-21(23)37-25)29-28-18-12-11-17(30(33)34)13-20(18)31(35)36/h3,5,8-13,28H,4,6-7H2,1-2H3/b29-19+ |
| InChIKey | XVEWAXPWPCOQGR-VUTHCHCSSA-N |
| XLogP | 5.63 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|