C26H22N4O4 — CID 19158713
(2-methylquinolin-8-yl) (4E)-3-methyl-4-(pyridine-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19158713) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) (4E)-3-methyl-4-(pyridine-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (2-methylquinolin-8-yl) (4E)-3-methyl-4-(pyridine-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19158713 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (2-methylquinolin-8-yl) (4E)-3-methyl-4-(pyridine-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc2cccc(OC(=O)c3oc4c(c3C)/C(=N/NC(=O)c3ccccn3)CCC4)c2n1 |
| InChI | InChI=1S/C26H22N4O4/c1-15-12-13-17-7-5-11-21(23(17)28-15)34-26(32)24-16(2)22-18(9-6-10-20(22)33-24)29-30-25(31)19-8-3-4-14-27-19/h3-5,7-8,11-14H,6,9-10H2,1-2H3,(H,30,31)/b29-18+ |
| InChIKey | KVNNZBBPAJMTCZ-RDRPBHBLSA-N |
| XLogP | 4.53 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|