C29H21BrN4O4 — CID 19162918
(5-bromoquinolin-8-yl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19162918) has the molecular formula C29H21BrN4O4 and a molecular weight of 569.42 g/mol. Its IUPAC name is (5-bromoquinolin-8-yl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (5-bromoquinolin-8-yl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19162918 |
| Molecular Formula | C29H21BrN4O4 |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | (5-bromoquinolin-8-yl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(Br)c3cccnc23)oc2c1/C(=N/NC(=O)c1ccc3ccccc3n1)CCC2 |
| InChI | InChI=1S/C29H21BrN4O4/c1-16-25-21(33-34-28(35)22-13-11-17-6-2-3-8-20(17)32-22)9-4-10-23(25)37-27(16)29(36)38-24-14-12-19(30)18-7-5-15-31-26(18)24/h2-3,5-8,11-15H,4,9-10H2,1H3,(H,34,35)/b33-21+ |
| InChIKey | VSMMUUCXYMTYBC-QNKGDIEWSA-N |
| XLogP | 6.14 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|