C28H26N4O5 — CID 19162843
N-[(E)-[2-[(2,4-dimethoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]quinoline-2-carboxamide (PubChem CID 19162843) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is N-[(E)-[2-[(2,4-dimethoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]quinoline-2-carboxamide.
| Compound Name | N-[(E)-[2-[(2,4-dimethoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 19162843 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(E)-[2-[(2,4-dimethoxyphenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]quinoline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2oc3c(c2C)/C(=N/NC(=O)c2ccc4ccccc4n2)CCC3)c(OC)c1 |
| InChI | InChI=1S/C28H26N4O5/c1-16-25-21(31-32-27(33)22-13-11-17-7-4-5-8-19(17)29-22)9-6-10-23(25)37-26(16)28(34)30-20-14-12-18(35-2)15-24(20)36-3/h4-5,7-8,11-15H,6,9-10H2,1-3H3,(H,30,34)(H,32,33)/b31-21+ |
| InChIKey | FJFYBRRHPVWPTL-NJZRLIGZSA-N |
| XLogP | 4.88 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|