C28H25N3O4 — CID 19162800
(3,5-dimethylphenyl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19162800) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is (3,5-dimethylphenyl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (3,5-dimethylphenyl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19162800 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (3,5-dimethylphenyl) (4E)-3-methyl-4-(quinoline-2-carbonylhydrazinylidene)-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc(C)cc(OC(=O)c2oc3c(c2C)/C(=N/NC(=O)c2ccc4ccccc4n2)CCC3)c1 |
| InChI | InChI=1S/C28H25N3O4/c1-16-13-17(2)15-20(14-16)34-28(33)26-18(3)25-22(9-6-10-24(25)35-26)30-31-27(32)23-12-11-19-7-4-5-8-21(19)29-23/h4-5,7-8,11-15H,6,9-10H2,1-3H3,(H,31,32)/b30-22+ |
| InChIKey | HFWSNVYMHATJEJ-JBASAIQMSA-N |
| XLogP | 5.44 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|