C27H22BrN3O5 — CID 19158219
(5-bromoquinolin-8-yl) (4E)-4-[(4-methoxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19158219) has the molecular formula C27H22BrN3O5 and a molecular weight of 548.39 g/mol. Its IUPAC name is (5-bromoquinolin-8-yl) (4E)-4-[(4-methoxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (5-bromoquinolin-8-yl) (4E)-4-[(4-methoxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19158219 |
| Molecular Formula | C27H22BrN3O5 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | (5-bromoquinolin-8-yl) (4E)-4-[(4-methoxybenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | COc1ccc(C(=O)N/N=C2\CCCc3oc(C(=O)Oc4ccc(Br)c5cccnc45)c(C)c32)cc1 |
| InChI | InChI=1S/C27H22BrN3O5/c1-15-23-20(30-31-26(32)16-8-10-17(34-2)11-9-16)6-3-7-21(23)35-25(15)27(33)36-22-13-12-19(28)18-5-4-14-29-24(18)22/h4-5,8-14H,3,6-7H2,1-2H3,(H,31,32)/b30-20+ |
| InChIKey | YOZLCMGEHKNEFW-TWKHWXDSSA-N |
| XLogP | 5.60 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|