C26H19BrF3N3O3 — CID 19161745
(5-bromoquinolin-8-yl) (4E)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19161745) has the molecular formula C26H19BrF3N3O3 and a molecular weight of 558.35 g/mol. Its IUPAC name is (5-bromoquinolin-8-yl) (4E)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (5-bromoquinolin-8-yl) (4E)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19161745 |
| Molecular Formula | C26H19BrF3N3O3 |
| Molecular Weight | 558.35 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | (5-bromoquinolin-8-yl) (4E)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(Br)c3cccnc23)oc2c1/C(=N/Nc1cccc(C(F)(F)F)c1)CCC2 |
| InChI | InChI=1S/C26H19BrF3N3O3/c1-14-22-19(33-32-16-6-2-5-15(13-16)26(28,29)30)8-3-9-20(22)35-24(14)25(34)36-21-11-10-18(27)17-7-4-12-31-23(17)21/h2,4-7,10-13,32H,3,8-9H2,1H3/b33-19+ |
| InChIKey | NRQAPVRVLCHUMD-HNSNBQBZSA-N |
| XLogP | 7.29 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.35 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|