C24H21BrF3N3O2 — CID 19161741
(4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19161741) has the molecular formula C24H21BrF3N3O2 and a molecular weight of 520.35 g/mol. Its IUPAC name is (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19161741 |
| Molecular Formula | C24H21BrF3N3O2 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | (4E)-N-(2-bromo-4-methylphenyl)-3-methyl-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3c(c2C)/C(=N/Nc2cccc(C(F)(F)F)c2)CCC3)c(Br)c1 |
| InChI | InChI=1S/C24H21BrF3N3O2/c1-13-9-10-18(17(25)11-13)29-23(32)22-14(2)21-19(7-4-8-20(21)33-22)31-30-16-6-3-5-15(12-16)24(26,27)28/h3,5-6,9-12,30H,4,7-8H2,1-2H3,(H,29,32)/b31-19+ |
| InChIKey | RJRHQWVNIRQPPZ-ZCTHSVRISA-N |
| XLogP | 7.08 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|