C23H21BrFN3O4S — CID 19163082
(4E)-N-(2-bromo-4-methylphenyl)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19163082) has the molecular formula C23H21BrFN3O4S and a molecular weight of 534.41 g/mol. Its IUPAC name is (4E)-N-(2-bromo-4-methylphenyl)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(2-bromo-4-methylphenyl)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19163082 |
| Molecular Formula | C23H21BrFN3O4S |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | (4E)-N-(2-bromo-4-methylphenyl)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3c(c2C)/C(=N/NS(=O)(=O)c2ccc(F)cc2)CCC3)c(Br)c1 |
| InChI | InChI=1S/C23H21BrFN3O4S/c1-13-6-11-18(17(24)12-13)26-23(29)22-14(2)21-19(4-3-5-20(21)32-22)27-28-33(30,31)16-9-7-15(25)8-10-16/h6-12,28H,3-5H2,1-2H3,(H,26,29)/b27-19+ |
| InChIKey | RPHOGNKPYRTESW-ZXVVBBHZSA-N |
| XLogP | 5.07 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|