C28H24FN3O5S — CID 19162957
(4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19162957) has the molecular formula C28H24FN3O5S and a molecular weight of 533.58 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19162957 |
| Molecular Formula | C28H24FN3O5S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Oc3ccccc3)cc2)oc2c1/C(=N/NS(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C28H24FN3O5S/c1-18-26-24(31-32-38(34,35)23-16-10-19(29)11-17-23)8-5-9-25(26)37-27(18)28(33)30-20-12-14-22(15-13-20)36-21-6-3-2-4-7-21/h2-4,6-7,10-17,32H,5,8-9H2,1H3,(H,30,33)/b31-24+ |
| InChIKey | DRIOTGXZPKRODZ-QFMPWRQOSA-N |
| XLogP | 5.79 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|