C30H27N3O5 — CID 19157250
(4E)-4-[(2-methoxybenzoyl)hydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19157250) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is (4E)-4-[(2-methoxybenzoyl)hydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2-methoxybenzoyl)hydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19157250 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (4E)-4-[(2-methoxybenzoyl)hydrazinylidene]-3-methyl-N-(4-phenoxyphenyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | COc1ccccc1C(=O)N/N=C1\CCCc2oc(C(=O)Nc3ccc(Oc4ccccc4)cc3)c(C)c21 |
| InChI | InChI=1S/C30H27N3O5/c1-19-27-24(32-33-29(34)23-11-6-7-13-25(23)36-2)12-8-14-26(27)38-28(19)30(35)31-20-15-17-22(18-16-20)37-21-9-4-3-5-10-21/h3-7,9-11,13,15-18H,8,12,14H2,1-2H3,(H,31,35)(H,33,34)/b32-24+ |
| InChIKey | OPBVOUCMSHNXQW-FEZSWGLMSA-N |
| XLogP | 6.11 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|