C28H24N4O4 — CID 19158594
N-[(E)-[3-methyl-2-[(4-phenoxyphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide (PubChem CID 19158594) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-[(E)-[3-methyl-2-[(4-phenoxyphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-[3-methyl-2-[(4-phenoxyphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19158594 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[(E)-[3-methyl-2-[(4-phenoxyphenyl)carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Oc3ccccc3)cc2)oc2c1/C(=N/NC(=O)c1ccccn1)CCC2 |
| InChI | InChI=1S/C28H24N4O4/c1-18-25-22(31-32-27(33)23-10-5-6-17-29-23)11-7-12-24(25)36-26(18)28(34)30-19-13-15-21(16-14-19)35-20-8-3-2-4-9-20/h2-6,8-10,13-17H,7,11-12H2,1H3,(H,30,34)(H,32,33)/b31-22+ |
| InChIKey | NZFFDYPTRZPPAB-DFKUXCBWSA-N |
| XLogP | 5.50 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|