C22H18Cl2N4O3 — CID 19158628
N-[(E)-[2-[(3,4-dichlorophenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide (PubChem CID 19158628) has the molecular formula C22H18Cl2N4O3 and a molecular weight of 457.32 g/mol. Its IUPAC name is N-[(E)-[2-[(3,4-dichlorophenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-[2-[(3,4-dichlorophenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19158628 |
| Molecular Formula | C22H18Cl2N4O3 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[(E)-[2-[(3,4-dichlorophenyl)carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Cl)c(Cl)c2)oc2c1/C(=N/NC(=O)c1ccccn1)CCC2 |
| InChI | InChI=1S/C22H18Cl2N4O3/c1-12-19-16(27-28-21(29)17-5-2-3-10-25-17)6-4-7-18(19)31-20(12)22(30)26-13-8-9-14(23)15(24)11-13/h2-3,5,8-11H,4,6-7H2,1H3,(H,26,30)(H,28,29)/b27-16+ |
| InChIKey | QQNAYZWTKMIGBO-JVWAILMASA-N |
| XLogP | 5.01 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|