C23H20ClFN4O5S — CID 19163059
N-[(E)-[2-[[(3-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-fluorobenzenesulfonamide (PubChem CID 19163059) has the molecular formula C23H20ClFN4O5S and a molecular weight of 518.95 g/mol. Its IUPAC name is N-[(E)-[2-[[(3-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(E)-[2-[[(3-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 19163059 |
| Molecular Formula | C23H20ClFN4O5S |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N-[(E)-[2-[[(3-chlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-fluorobenzenesulfonamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccc(Cl)c2)oc2c1/C(=N/NS(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C23H20ClFN4O5S/c1-13-20-18(26-29-35(32,33)17-10-8-16(25)9-11-17)6-3-7-19(20)34-21(13)23(31)28-27-22(30)14-4-2-5-15(24)12-14/h2,4-5,8-12,29H,3,6-7H2,1H3,(H,27,30)(H,28,31)/b26-18+ |
| InChIKey | WIACSCXIGCVTDP-NLRVBDNBSA-N |
| XLogP | 3.47 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|