C25H24Cl2N4O6S — CID 19159709
N-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 19159709) has the molecular formula C25H24Cl2N4O6S and a molecular weight of 579.46 g/mol. Its IUPAC name is N-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 19159709 |
| Molecular Formula | C25H24Cl2N4O6S |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | N-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCCc3oc(C(=O)NNC(=O)COc4ccc(Cl)cc4Cl)c(C)c32)cc1 |
| InChI | InChI=1S/C25H24Cl2N4O6S/c1-14-6-9-17(10-7-14)38(34,35)31-28-19-4-3-5-21-23(19)15(2)24(37-21)25(33)30-29-22(32)13-36-20-11-8-16(26)12-18(20)27/h6-12,31H,3-5,13H2,1-2H3,(H,29,32)(H,30,33)/b28-19+ |
| InChIKey | GNEQSZFCHLGEPL-TURZUDJPSA-N |
| XLogP | 4.06 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|