C26H24Cl2N4O6 — CID 19160376
2-(2,4-dichlorophenoxy)-N-[(E)-[2-[[(4-methoxybenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide (PubChem CID 19160376) has the molecular formula C26H24Cl2N4O6 and a molecular weight of 559.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-[2-[[(4-methoxybenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[2-[[(4-methoxybenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 19160376 |
| Molecular Formula | C26H24Cl2N4O6 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[2-[[(4-methoxybenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2oc3c(c2C)/C(=N/NC(=O)COc2ccc(Cl)cc2Cl)CCC3)cc1 |
| InChI | InChI=1S/C26H24Cl2N4O6/c1-14-23-19(29-30-22(33)13-37-20-11-8-16(27)12-18(20)28)4-3-5-21(23)38-24(14)26(35)32-31-25(34)15-6-9-17(36-2)10-7-15/h6-12H,3-5,13H2,1-2H3,(H,30,33)(H,31,34)(H,32,35)/b29-19+ |
| InChIKey | NMRBAESGKRCOOK-VUTHCHCSSA-N |
| XLogP | 4.21 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|