C26H25Cl2N3O6 — CID 19160326
(4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160326) has the molecular formula C26H25Cl2N3O6 and a molecular weight of 546.41 g/mol. Its IUPAC name is (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160326 |
| Molecular Formula | C26H25Cl2N3O6 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2,4-dimethoxyphenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2oc3c(c2C)/C(=N/NC(=O)COc2ccc(Cl)cc2Cl)CCC3)c(OC)c1 |
| InChI | InChI=1S/C26H25Cl2N3O6/c1-14-24-19(30-31-23(32)13-36-20-10-7-15(27)11-17(20)28)5-4-6-21(24)37-25(14)26(33)29-18-9-8-16(34-2)12-22(18)35-3/h7-12H,4-6,13H2,1-3H3,(H,29,33)(H,31,32)/b30-19+ |
| InChIKey | PWEQYMWMOIIOFU-NDZAJKAJSA-N |
| XLogP | 5.40 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|