C24H20Cl2FN3O4 — CID 19160271
(4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160271) has the molecular formula C24H20Cl2FN3O4 and a molecular weight of 504.35 g/mol. Its IUPAC name is (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160271 |
| Molecular Formula | C24H20Cl2FN3O4 |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(2-fluorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2F)oc2c1/C(=N/NC(=O)COc1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C24H20Cl2FN3O4/c1-13-22-18(29-30-21(31)12-33-19-10-9-14(25)11-15(19)26)7-4-8-20(22)34-23(13)24(32)28-17-6-3-2-5-16(17)27/h2-3,5-6,9-11H,4,7-8,12H2,1H3,(H,28,32)(H,30,31)/b29-18+ |
| InChIKey | QKHHFOSSONRILU-RDRPBHBLSA-N |
| XLogP | 5.52 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|