C24H19Cl4N3O4 — CID 19160299
(4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(3,5-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19160299) has the molecular formula C24H19Cl4N3O4 and a molecular weight of 555.25 g/mol. Its IUPAC name is (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(3,5-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(3,5-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19160299 |
| Molecular Formula | C24H19Cl4N3O4 |
| Molecular Weight | 555.25 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-N-(3,5-dichlorophenyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)cc(Cl)c2)oc2c1/C(=N/NC(=O)COc1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C24H19Cl4N3O4/c1-12-22-18(30-31-21(32)11-34-19-6-5-13(25)10-17(19)28)3-2-4-20(22)35-23(12)24(33)29-16-8-14(26)7-15(27)9-16/h5-10H,2-4,11H2,1H3,(H,29,33)(H,31,32)/b30-18+ |
| InChIKey | YCILKWIHVJCVFP-UXHLAJHPSA-N |
| XLogP | 6.69 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.25 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|