C26H22Cl2N2O7 — CID 19160298
(4-methoxycarbonylphenyl) (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19160298) has the molecular formula C26H22Cl2N2O7 and a molecular weight of 545.38 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19160298 |
| Molecular Formula | C26H22Cl2N2O7 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | (4-methoxycarbonylphenyl) (4E)-4-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2oc3c(c2C)/C(=N/NC(=O)COc2ccc(Cl)cc2Cl)CCC3)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O7/c1-14-23-19(29-30-22(31)13-35-20-11-8-16(27)12-18(20)28)4-3-5-21(23)37-24(14)26(33)36-17-9-6-15(7-10-17)25(32)34-2/h6-12H,3-5,13H2,1-2H3,(H,30,31)/b29-19+ |
| InChIKey | NCACRXLOHNGEBN-VUTHCHCSSA-N |
| XLogP | 5.14 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|