C25H21Cl2N5O7 — CID 19160368
2-(2,4-dichlorophenoxy)-N-[(E)-[3-methyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide (PubChem CID 19160368) has the molecular formula C25H21Cl2N5O7 and a molecular weight of 574.38 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-[3-methyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[3-methyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 19160368 |
| Molecular Formula | C25H21Cl2N5O7 |
| Molecular Weight | 574.38 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[3-methyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]acetamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])oc2c1/C(=N/NC(=O)COc1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C25H21Cl2N5O7/c1-13-22-17(28-29-21(33)12-38-19-10-9-14(26)11-16(19)27)6-4-8-20(22)39-23(13)25(35)31-30-24(34)15-5-2-3-7-18(15)32(36)37/h2-3,5,7,9-11H,4,6,8,12H2,1H3,(H,29,33)(H,30,34)(H,31,35)/b28-17+ |
| InChIKey | CZEILVAKIJCGSV-OGLMXYFKSA-N |
| XLogP | 4.11 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|