C19H20Cl2N6O4 — CID 19162394
2-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine (PubChem CID 19162394) has the molecular formula C19H20Cl2N6O4 and a molecular weight of 467.31 g/mol. Its IUPAC name is 2-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 19162394 |
| Molecular Formula | C19H20Cl2N6O4 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[(E)-[2-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]guanidine |
| SMILES | Cc1c(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)oc2c1/C(=N/N=C(N)N)CCC2 |
| InChI | InChI=1S/C19H20Cl2N6O4/c1-9-16-12(24-27-19(22)23)3-2-4-14(16)31-17(9)18(29)26-25-15(28)8-30-13-6-5-10(20)7-11(13)21/h5-7H,2-4,8H2,1H3,(H,25,28)(H,26,29)(H4,22,23,27)/b24-12+ |
| InChIKey | UVDVVIPLUKCKFA-WYMPLXKRSA-N |
| XLogP | 2.05 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|