C16H17ClN6O2 — CID 19162353
(4E)-N-(5-chloro-2-pyridinyl)-4-(diaminomethylidenehydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19162353) has the molecular formula C16H17ClN6O2 and a molecular weight of 360.81 g/mol. Its IUPAC name is (4E)-N-(5-chloro-2-pyridinyl)-4-(diaminomethylidenehydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N-(5-chloro-2-pyridinyl)-4-(diaminomethylidenehydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19162353 |
| Molecular Formula | C16H17ClN6O2 |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (4E)-N-(5-chloro-2-pyridinyl)-4-(diaminomethylidenehydrazinylidene)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Cl)cn2)oc2c1/C(=N/N=C(N)N)CCC2 |
| InChI | InChI=1S/C16H17ClN6O2/c1-8-13-10(22-23-16(18)19)3-2-4-11(13)25-14(8)15(24)21-12-6-5-9(17)7-20-12/h5-7H,2-4H2,1H3,(H4,18,19,23)(H,20,21,24)/b22-10+ |
| InChIKey | OLPDFEOLFMUETM-LSHDLFTRSA-N |
| XLogP | 2.20 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|