C20H20Cl2N4O5 — CID 19162724
ethyl N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]carbamate (PubChem CID 19162724) has the molecular formula C20H20Cl2N4O5 and a molecular weight of 467.31 g/mol. Its IUPAC name is ethyl N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]carbamate.
| Compound Name | ethyl N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 19162724 |
| Molecular Formula | C20H20Cl2N4O5 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | ethyl N-[(E)-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]carbamate |
| SMILES | CCOC(=O)N/N=C1\CCCc2oc(C(=O)NNC(=O)c3ccc(Cl)cc3Cl)c(C)c21 |
| InChI | InChI=1S/C20H20Cl2N4O5/c1-3-30-20(29)26-23-14-5-4-6-15-16(14)10(2)17(31-15)19(28)25-24-18(27)12-8-7-11(21)9-13(12)22/h7-9H,3-6H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)/b23-14+ |
| InChIKey | RUNZJBIFJLMISU-OEAKJJBVSA-N |
| XLogP | 3.76 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|