C13H17N3O4 — CID 19162666
ethyl N-[(E)-(2-carbamoyl-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]carbamate (PubChem CID 19162666) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethyl N-[(E)-(2-carbamoyl-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]carbamate.
| Compound Name | ethyl N-[(E)-(2-carbamoyl-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]carbamate |
|---|---|
| PubChem CID | 19162666 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethyl N-[(E)-(2-carbamoyl-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]carbamate |
| SMILES | CCOC(=O)N/N=C1\CCCc2oc(C(N)=O)c(C)c21 |
| InChI | InChI=1S/C13H17N3O4/c1-3-19-13(18)16-15-8-5-4-6-9-10(8)7(2)11(20-9)12(14)17/h3-6H2,1-2H3,(H2,14,17)(H,16,18)/b15-8+ |
| InChIKey | YEYIDZAHALYQOK-OVCLIPMQSA-N |
| XLogP | 1.47 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|