C19H19BrN2O4 — CID 19157056
ethyl (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19157056) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is ethyl (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | ethyl (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19157056 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | ethyl (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(c1C)/C(=N/NC(=O)c1ccccc1Br)CCC2 |
| InChI | InChI=1S/C19H19BrN2O4/c1-3-25-19(24)17-11(2)16-14(9-6-10-15(16)26-17)21-22-18(23)12-7-4-5-8-13(12)20/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,22,23)/b21-14+ |
| InChIKey | PNUUNUUIPKXIQC-KGENOOAVSA-N |
| XLogP | 4.00 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|